C24H23F2N3O3 — CID 143284473
2-[2-(1,1-difluoroethyl)phenyl]-1-[2-(4-nitronaphthalen-1-yl)diazinan-1-yl]ethanone (PubChem CID 143284473) has the molecular formula C24H23F2N3O3 and a molecular weight of 439.46 g/mol. Its IUPAC name is 2-[2-(1,1-difluoroethyl)phenyl]-1-[2-(4-nitronaphthalen-1-yl)diazinan-1-yl]ethanone.
| Compound Name | 2-[2-(1,1-difluoroethyl)phenyl]-1-[2-(4-nitronaphthalen-1-yl)diazinan-1-yl]ethanone |
|---|---|
| PubChem CID | 143284473 |
| Molecular Formula | C24H23F2N3O3 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-[2-(1,1-difluoroethyl)phenyl]-1-[2-(4-nitronaphthalen-1-yl)diazinan-1-yl]ethanone |
| SMILES | CC(F)(F)c1ccccc1CC(=O)N1CCCCN1c1ccc([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C24H23F2N3O3/c1-24(25,26)20-11-5-2-8-17(20)16-23(30)28-15-7-6-14-27(28)21-12-13-22(29(31)32)19-10-4-3-9-18(19)21/h2-5,8-13H,6-7,14-16H2,1H3 |
| InChIKey | JBODSGMACMICIW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|