C11H14O2 — CID 143284504
3,6-dihydrocyclohepta[b]furan-2-one;ethane (PubChem CID 143284504) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 3,6-dihydrocyclohepta[b]furan-2-one;ethane.
| Compound Name | 3,6-dihydrocyclohepta[b]furan-2-one;ethane |
|---|---|
| PubChem CID | 143284504 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3,6-dihydrocyclohepta[b]furan-2-one;ethane |
| SMILES | CC.O=C1CC2=C(C=CCC=C2)O1 |
| InChI | InChI=1S/C9H8O2.C2H6/c10-9-6-7-4-2-1-3-5-8(7)11-9;1-2/h2-5H,1,6H2;1-2H3 |
| InChIKey | XUZVWPBWCONFKD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |