C31H48ClF2N3O3 — CID 143284566
N-[5-chloro-4-fluoro-2-[[2-(2-fluoro-3-methylphenyl)propylamino]methyl]phenyl]formamide;2,2-dimethylpropane;N-(4-propoxybutyl)formamide (PubChem CID 143284566) has the molecular formula C31H48ClF2N3O3 and a molecular weight of 584.19 g/mol. Its IUPAC name is N-[5-chloro-4-fluoro-2-[[2-(2-fluoro-3-methylphenyl)propylamino]methyl]phenyl]formamide;2,2-dimethylpropane;N-(4-propoxybutyl)formamide.
| Compound Name | N-[5-chloro-4-fluoro-2-[[2-(2-fluoro-3-methylphenyl)propylamino]methyl]phenyl]formamide;2,2-dimethylpropane;N-(4-propoxybutyl)formamide |
|---|---|
| PubChem CID | 143284566 |
| Molecular Formula | C31H48ClF2N3O3 |
| Molecular Weight | 584.19 g/mol |
| Exact Mass | 583.34 |
| IUPAC Name | N-[5-chloro-4-fluoro-2-[[2-(2-fluoro-3-methylphenyl)propylamino]methyl]phenyl]formamide;2,2-dimethylpropane;N-(4-propoxybutyl)formamide |
| SMILES | CC(C)(C)C.CCCOCCCCNC=O.Cc1cccc(C(C)CNCc2cc(F)c(Cl)cc2NC=O)c1F |
| InChI | InChI=1S/C18H19ClF2N2O.C8H17NO2.C5H12/c1-11-4-3-5-14(18(11)21)12(2)8-22-9-13-6-16(20)15(19)7-17(13)23-10-24;1-2-6-11-7-4-3-5-9-8-10;1-5(2,3)4/h3-7,10,12,22H,8-9H2,1-2H3,(H,23,24);8H,2-7H2,1H3,(H,9,10);1-4H3 |
| InChIKey | RCNQMUJVBYSVGI-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.19 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|