C31H33ClN2O5 — CID 143284843
ethyl 4-[4-[(4S)-4-[(4-chlorophenyl)-ethylcarbamoyl]-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]butanoate (PubChem CID 143284843) has the molecular formula C31H33ClN2O5 and a molecular weight of 549.07 g/mol. Its IUPAC name is ethyl 4-[4-[(4S)-4-[(4-chlorophenyl)-ethylcarbamoyl]-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]butanoate.
| Compound Name | ethyl 4-[4-[(4S)-4-[(4-chlorophenyl)-ethylcarbamoyl]-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 143284843 |
| Molecular Formula | C31H33ClN2O5 |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | ethyl 4-[4-[(4S)-4-[(4-chlorophenyl)-ethylcarbamoyl]-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(C(=O)N2CC[C@H](C(=O)N(CC)c3ccc(Cl)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H33ClN2O5/c1-3-33(24-15-13-23(32)14-16-24)31(37)27-19-20-34(28-9-6-5-8-26(27)28)30(36)22-11-17-25(18-12-22)39-21-7-10-29(35)38-4-2/h5-6,8-9,11-18,27H,3-4,7,10,19-21H2,1-2H3/t27-/m0/s1 |
| InChIKey | NQCVSJCQDLTFPD-MHZLTWQESA-N |
| XLogP | 6.25 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|