C25H29NO4 — CID 143288537
[(5R,6aS)-2-oxo-4-[(2R)-1-(2-phenylethylamino)propan-2-yl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 143288537) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is [(5R,6aS)-2-oxo-4-[(2R)-1-(2-phenylethylamino)propan-2-yl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(5R,6aS)-2-oxo-4-[(2R)-1-(2-phenylethylamino)propan-2-yl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 143288537 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [(5R,6aS)-2-oxo-4-[(2R)-1-(2-phenylethylamino)propan-2-yl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | CC(CNCCc1ccccc1)C1C2CC(=O)O[C@H]2C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H29NO4/c1-17(16-26-13-12-18-8-4-2-5-9-18)24-20-14-23(27)29-21(20)15-22(24)30-25(28)19-10-6-3-7-11-19/h2-11,17,20-22,24,26H,12-16H2,1H3/t17?,20?,21-,22+,24?/m0/s1 |
| InChIKey | RNGIMCREGPLZOW-KPLQBRCDSA-N |
| XLogP | 3.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|