C9H16N2O6 — CID 143288949
(4S)-4-[(2S)-2-hydroxy-3-nitropropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (PubChem CID 143288949) has the molecular formula C9H16N2O6 and a molecular weight of 248.23 g/mol. Its IUPAC name is (4S)-4-[(2S)-2-hydroxy-3-nitropropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
| Compound Name | (4S)-4-[(2S)-2-hydroxy-3-nitropropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 143288949 |
| Molecular Formula | C9H16N2O6 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (4S)-4-[(2S)-2-hydroxy-3-nitropropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| SMILES | CC1(C)OC[C@H](C[C@H](O)C[N+](=O)[O-])N1C(=O)O |
| InChI | InChI=1S/C9H16N2O6/c1-9(2)11(8(13)14)6(5-17-9)3-7(12)4-10(15)16/h6-7,12H,3-5H2,1-2H3,(H,13,14)/t6-,7-/m0/s1 |
| InChIKey | BQXPJNKKTUCVFJ-BQBZGAKWSA-N |
| XLogP | 0.13 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|