C10H17NO4 — CID 18646911
(4S)-4-[(1S)-1-hydroxybut-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (PubChem CID 18646911) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is (4S)-4-[(1S)-1-hydroxybut-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
| Compound Name | (4S)-4-[(1S)-1-hydroxybut-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 18646911 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | (4S)-4-[(1S)-1-hydroxybut-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| SMILES | C=CC[C@H](O)[C@@H]1COC(C)(C)N1C(=O)O |
| InChI | InChI=1S/C10H17NO4/c1-4-5-8(12)7-6-15-10(2,3)11(7)9(13)14/h4,7-8,12H,1,5-6H2,2-3H3,(H,13,14)/t7-,8-/m0/s1 |
| InChIKey | HOKSPHIOBIEFKS-YUMQZZPRSA-N |
| XLogP | 1.04 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|