C14H19F6NO3 — CID 175585295
4-[2-(difluoromethyl)-1,1,1,3-tetrafluorohept-6-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (PubChem CID 175585295) has the molecular formula C14H19F6NO3 and a molecular weight of 363.30 g/mol. Its IUPAC name is 4-[2-(difluoromethyl)-1,1,1,3-tetrafluorohept-6-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
| Compound Name | 4-[2-(difluoromethyl)-1,1,1,3-tetrafluorohept-6-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 175585295 |
| Molecular Formula | C14H19F6NO3 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-[2-(difluoromethyl)-1,1,1,3-tetrafluorohept-6-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| SMILES | C=CCCC(F)C(C(F)F)(C1COC(C)(C)N1C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C14H19F6NO3/c1-4-5-6-8(15)13(10(16)17,14(18,19)20)9-7-24-12(2,3)21(9)11(22)23/h4,8-10H,1,5-7H2,2-3H3,(H,22,23) |
| InChIKey | PVXDJQHOXJNCOR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|