C11H19NO4 — CID 166756964
(4S)-4-[(2R)-2-hydroxypent-4-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (PubChem CID 166756964) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (4S)-4-[(2R)-2-hydroxypent-4-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
| Compound Name | (4S)-4-[(2R)-2-hydroxypent-4-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166756964 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (4S)-4-[(2R)-2-hydroxypent-4-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| SMILES | C=CC[C@@](C)(O)[C@@H]1COC(C)(C)N1C(=O)O |
| InChI | InChI=1S/C11H19NO4/c1-5-6-11(4,15)8-7-16-10(2,3)12(8)9(13)14/h5,8,15H,1,6-7H2,2-4H3,(H,13,14)/t8-,11+/m0/s1 |
| InChIKey | VXQLEDUOMWTHOH-GZMMTYOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|