About 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane
2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane (PubChem CID 143289444) has the molecular formula C24H37IrN
and a molecular weight of 531.78 g/mol. Its IUPAC name is 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane.
Molecular Properties
| Compound Name | 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane |
| PubChem CID | 143289444 |
| Molecular Formula | C24H37IrN |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane |
| SMILES | CCCCC.CCCCc1ccc(-c2ccccn2)c(C(C)CC)c1.[Ir] |
| InChI | InChI=1S/C19H25N.C5H12.Ir/c1-4-6-9-16-11-12-17(18(14-16)15(3)5-2)19-10-7-8-13-20-19;1-3-5-4-2;/h7-8,10-15H,4-6,9H2,1-3H3;3-5H2,1-2H3; |
| InChIKey | ZSCNQNNOANDESK-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane?
The IUPAC name of 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane (CID 143289444) is 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane.
What is the SMILES notation for 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane?
The canonical SMILES for 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane is CCCCC.CCCCc1ccc(-c2ccccn2)c(C(C)CC)c1.[Ir].
What is the InChIKey of 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane?
The InChIKey is ZSCNQNNOANDESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N.C5H12.Ir/c1-4-6-9-16-11-12-17(18(14-16)15(3)5-2)19-10-7-8-13-20-19;1-3-5-4-2;/h7-8,10-15H,4-6,9H2,1-3H3;3-5H2,1-2H3;.
What are the key properties of 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane?
2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane has a molecular weight of 531.78 g/mol, XLogP of 7.80, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butan-2-yl-4-butylphenyl)pyridine;iridium;pentane is sourced from PubChem (CID 143289444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).