C17H17N — CID 143289961
6-methyl-2-(5-methylcyclohexa-1,3-dien-1-yl)quinoline (PubChem CID 143289961) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 6-methyl-2-(5-methylcyclohexa-1,3-dien-1-yl)quinoline.
| Compound Name | 6-methyl-2-(5-methylcyclohexa-1,3-dien-1-yl)quinoline |
|---|---|
| PubChem CID | 143289961 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-methyl-2-(5-methylcyclohexa-1,3-dien-1-yl)quinoline |
| SMILES | Cc1ccc2nc(C3=CC=CC(C)C3)ccc2c1 |
| InChI | InChI=1S/C17H17N/c1-12-4-3-5-14(10-12)17-9-7-15-11-13(2)6-8-16(15)18-17/h3-9,11-12H,10H2,1-2H3 |
| InChIKey | LHSWGPCHTSQBLB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |