C32H44N6O2 — CID 143290241
tert-butyl N-[[1-[2-(3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-ylmethyl)imidazo[1,2-a]pyridin-5-yl]azepan-4-yl]methyl]carbamate (PubChem CID 143290241) has the molecular formula C32H44N6O2 and a molecular weight of 544.74 g/mol. Its IUPAC name is tert-butyl N-[[1-[2-(3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-ylmethyl)imidazo[1,2-a]pyridin-5-yl]azepan-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[2-(3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-ylmethyl)imidazo[1,2-a]pyridin-5-yl]azepan-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 143290241 |
| Molecular Formula | C32H44N6O2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | tert-butyl N-[[1-[2-(3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-ylmethyl)imidazo[1,2-a]pyridin-5-yl]azepan-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCN(c2cccc3nc(CN4CCCC5CCc6cccnc6C54)cn23)CC1 |
| InChI | InChI=1S/C32H44N6O2/c1-32(2,3)40-31(39)34-20-23-8-6-17-36(19-15-23)28-12-4-11-27-35-26(22-38(27)28)21-37-18-7-10-25-14-13-24-9-5-16-33-29(24)30(25)37/h4-5,9,11-12,16,22-23,25,30H,6-8,10,13-15,17-21H2,1-3H3,(H,34,39) |
| InChIKey | CXXHBGKZYOAAAM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |