C30H40N6O2 — CID 11855712
tert-butyl 2-[[(4aS,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxylate (PubChem CID 11855712) has the molecular formula C30H40N6O2 and a molecular weight of 516.69 g/mol. Its IUPAC name is tert-butyl 2-[[(4aS,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-[[(4aS,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 11855712 |
| Molecular Formula | C30H40N6O2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | tert-butyl 2-[[(4aS,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxylate |
| SMILES | CN1CCN(c2cccc3c2nc(CN2CCC[C@@H]4CCc5cccnc5[C@H]42)n3C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C30H40N6O2/c1-30(2,3)38-29(37)36-24-11-5-10-23(34-18-16-33(4)17-19-34)27(24)32-25(36)20-35-15-7-9-22-13-12-21-8-6-14-31-26(21)28(22)35/h5-6,8,10-11,14,22,28H,7,9,12-13,15-20H2,1-4H3/t22-,28+/m1/s1 |
| InChIKey | ALYPPKBXSCOXAO-DFHRPNOPSA-N |
| XLogP | 4.87 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |