C26H27N5 — CID 86629232
(4aS,10bR)-1-[[1-(pyridin-2-ylmethyl)benzimidazol-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline (PubChem CID 86629232) has the molecular formula C26H27N5 and a molecular weight of 409.54 g/mol. Its IUPAC name is (4aS,10bR)-1-[[1-(pyridin-2-ylmethyl)benzimidazol-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline.
| Compound Name | (4aS,10bR)-1-[[1-(pyridin-2-ylmethyl)benzimidazol-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
|---|---|
| PubChem CID | 86629232 |
| Molecular Formula | C26H27N5 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (4aS,10bR)-1-[[1-(pyridin-2-ylmethyl)benzimidazol-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
| SMILES | c1ccc(Cn2c(CN3CCC[C@@H]4CCc5cccnc5[C@@H]43)nc3ccccc32)nc1 |
| InChI | InChI=1S/C26H27N5/c1-2-11-23-22(10-1)29-24(31(23)17-21-9-3-4-14-27-21)18-30-16-6-8-20-13-12-19-7-5-15-28-25(19)26(20)30/h1-5,7,9-11,14-15,20,26H,6,8,12-13,16-18H2/t20-,26-/m1/s1 |
| InChIKey | PCCVXYCZFCXQGM-FQRUVTKNSA-N |
| XLogP | 4.77 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |