C24H27N5 — CID 68942104
4-[2-[[(4aR,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]butanenitrile (PubChem CID 68942104) has the molecular formula C24H27N5 and a molecular weight of 385.52 g/mol. Its IUPAC name is 4-[2-[[(4aR,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]butanenitrile.
| Compound Name | 4-[2-[[(4aR,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 68942104 |
| Molecular Formula | C24H27N5 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 4-[2-[[(4aR,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]butanenitrile |
| SMILES | N#CCCCn1c(CN2CCC[C@H]3CCc4cccnc4[C@@H]32)nc2ccccc21 |
| InChI | InChI=1S/C24H27N5/c25-13-3-4-16-29-21-10-2-1-9-20(21)27-22(29)17-28-15-6-8-19-12-11-18-7-5-14-26-23(18)24(19)28/h1-2,5,7,9-10,14,19,24H,3-4,6,8,11-12,15-17H2/t19-,24+/m0/s1 |
| InChIKey | FUVBBGJANXVUSV-YADARESESA-N |
| XLogP | 4.63 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|