C20H22N4 — CID 68945912
(4aR,10bR)-1-(1H-benzimidazol-2-ylmethyl)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline (PubChem CID 68945912) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is (4aR,10bR)-1-(1H-benzimidazol-2-ylmethyl)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline.
| Compound Name | (4aR,10bR)-1-(1H-benzimidazol-2-ylmethyl)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
|---|---|
| PubChem CID | 68945912 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (4aR,10bR)-1-(1H-benzimidazol-2-ylmethyl)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
| SMILES | c1cnc2c(c1)CC[C@@H]1CCCN(Cc3nc4ccccc4[nH]3)[C@@H]21 |
| InChI | InChI=1S/C20H22N4/c1-2-8-17-16(7-1)22-18(23-17)13-24-12-4-6-15-10-9-14-5-3-11-21-19(14)20(15)24/h1-3,5,7-8,11,15,20H,4,6,9-10,12-13H2,(H,22,23)/t15-,20+/m0/s1 |
| InChIKey | DHTOXYDZAQVERB-MGPUTAFESA-N |
| XLogP | 3.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |