C27H36N4 — CID 161424442
(4aR,10bR)-1-[[(3R)-5-piperidin-1-yl-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline (PubChem CID 161424442) has the molecular formula C27H36N4 and a molecular weight of 416.61 g/mol. Its IUPAC name is (4aR,10bR)-1-[[(3R)-5-piperidin-1-yl-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline.
| Compound Name | (4aR,10bR)-1-[[(3R)-5-piperidin-1-yl-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
|---|---|
| PubChem CID | 161424442 |
| Molecular Formula | C27H36N4 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | (4aR,10bR)-1-[[(3R)-5-piperidin-1-yl-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
| SMILES | c1cnc2c(c1)CC[C@@H]1CCCN(C[C@H]3Cc4c(cccc4N4CCCCC4)CN3)[C@@H]21 |
| InChI | InChI=1S/C27H36N4/c1-2-14-30(15-3-1)25-10-4-7-22-18-29-23(17-24(22)25)19-31-16-6-9-21-12-11-20-8-5-13-28-26(20)27(21)31/h4-5,7-8,10,13,21,23,27,29H,1-3,6,9,11-12,14-19H2/t21-,23+,27+/m0/s1 |
| InChIKey | CTTRQLKLICIUSP-VBANMALSSA-N |
| XLogP | 4.49 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |