C25H33N5 — CID 86629229
5-[2-[[(4aS,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]pentan-1-amine (PubChem CID 86629229) has the molecular formula C25H33N5 and a molecular weight of 403.57 g/mol. Its IUPAC name is 5-[2-[[(4aS,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]pentan-1-amine.
| Compound Name | 5-[2-[[(4aS,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 86629229 |
| Molecular Formula | C25H33N5 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | 5-[2-[[(4aS,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]pentan-1-amine |
| SMILES | NCCCCCn1c(CN2CCC[C@@H]3CCc4cccnc4[C@@H]32)nc2ccccc21 |
| InChI | InChI=1S/C25H33N5/c26-14-4-1-5-17-30-22-11-3-2-10-21(22)28-23(30)18-29-16-7-9-20-13-12-19-8-6-15-27-24(19)25(20)29/h2-3,6,8,10-11,15,20,25H,1,4-5,7,9,12-14,16-18,26H2/t20-,25-/m1/s1 |
| InChIKey | XGJNMQDLQOFRGA-CJFMBICVSA-N |
| XLogP | 4.46 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|