C27H35N5O — CID 86629231
4-[3-[2-[[(4aS,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]propyl]morpholine (PubChem CID 86629231) has the molecular formula C27H35N5O and a molecular weight of 445.61 g/mol. Its IUPAC name is 4-[3-[2-[[(4aS,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]propyl]morpholine.
| Compound Name | 4-[3-[2-[[(4aS,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]propyl]morpholine |
|---|---|
| PubChem CID | 86629231 |
| Molecular Formula | C27H35N5O |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 4-[3-[2-[[(4aS,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]propyl]morpholine |
| SMILES | c1cnc2c(c1)CC[C@H]1CCCN(Cc3nc4ccccc4n3CCCN3CCOCC3)[C@@H]21 |
| InChI | InChI=1S/C27H35N5O/c1-2-9-24-23(8-1)29-25(32(24)15-5-13-30-16-18-33-19-17-30)20-31-14-4-7-22-11-10-21-6-3-12-28-26(21)27(22)31/h1-3,6,8-9,12,22,27H,4-5,7,10-11,13-20H2/t22-,27-/m1/s1 |
| InChIKey | XKPJSZRLYABZHE-AJTFRIOCSA-N |
| XLogP | 4.05 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |