C27H34N6 — CID 69481664
1-[[5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline (PubChem CID 69481664) has the molecular formula C27H34N6 and a molecular weight of 442.61 g/mol. Its IUPAC name is 1-[[5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline.
| Compound Name | 1-[[5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
|---|---|
| PubChem CID | 69481664 |
| Molecular Formula | C27H34N6 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 1-[[5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
| SMILES | c1cnc2c(c1)CCC1CCCN(Cc3cn4c(N5CCN6CCC[C@H]6C5)cccc4n3)C21 |
| InChI | InChI=1S/C27H34N6/c1-8-24-29-22(18-33(24)25(9-1)31-16-15-30-13-4-7-23(30)19-31)17-32-14-3-6-21-11-10-20-5-2-12-28-26(20)27(21)32/h1-2,5,8-9,12,18,21,23,27H,3-4,6-7,10-11,13-17,19H2/t21?,23-,27?/m0/s1 |
| InChIKey | JQRMXKBXTJQYNI-DWNDAPBDSA-N |
| XLogP | 3.91 |
| TPSA | 39.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |