C16H24F3N — CID 143290463
ethane;1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 143290463) has the molecular formula C16H24F3N and a molecular weight of 287.37 g/mol. Its IUPAC name is ethane;1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | ethane;1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143290463 |
| Molecular Formula | C16H24F3N |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | ethane;1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | C=C/C=C(\C=C/C)C12CC1CN(CC(F)(F)F)C2.CC |
| InChI | InChI=1S/C14H18F3N.C2H6/c1-3-5-11(6-4-2)13-7-12(13)8-18(9-13)10-14(15,16)17;1-2/h3-6,12H,1,7-10H2,2H3;1-2H3/b6-4-,11-5+; |
| InChIKey | TXPYXRYKCKGDNX-BSQCVAITSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|