C16H20F3N — CID 143290498
1-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 143290498) has the molecular formula C16H20F3N and a molecular weight of 283.34 g/mol. Its IUPAC name is 1-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | 1-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143290498 |
| Molecular Formula | C16H20F3N |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | C=C/C=C(\C=C/C=C\C)C12CC1CN(CC(F)(F)F)C2 |
| InChI | InChI=1S/C16H20F3N/c1-3-5-6-8-13(7-4-2)15-9-14(15)10-20(11-15)12-16(17,18)19/h3-8,14H,2,9-12H2,1H3/b5-3-,8-6-,13-7+ |
| InChIKey | TXCCFZXXQNKXMW-ZDHGGEHDSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|