C21H30N4O4 — CID 143290518
1-(2-formamido-4-phenylbutanoyl)pyrrolidine-2-carboxamide;5-methylpyrrolidin-2-one (PubChem CID 143290518) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-(2-formamido-4-phenylbutanoyl)pyrrolidine-2-carboxamide;5-methylpyrrolidin-2-one.
| Compound Name | 1-(2-formamido-4-phenylbutanoyl)pyrrolidine-2-carboxamide;5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 143290518 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1-(2-formamido-4-phenylbutanoyl)pyrrolidine-2-carboxamide;5-methylpyrrolidin-2-one |
| SMILES | CC1CCC(=O)N1.NC(=O)C1CCCN1C(=O)C(CCc1ccccc1)NC=O |
| InChI | InChI=1S/C16H21N3O3.C5H9NO/c17-15(21)14-7-4-10-19(14)16(22)13(18-11-20)9-8-12-5-2-1-3-6-12;1-4-2-3-5(7)6-4/h1-3,5-6,11,13-14H,4,7-10H2,(H2,17,21)(H,18,20);4H,2-3H2,1H3,(H,6,7) |
| InChIKey | PISIKMJUNDFUDC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|