C27H31NO2 — CID 143291696
4-[2-[3-(2-methylpropyl)phenyl]ethyl]-2-(2-phenylethylamino)benzoic acid (PubChem CID 143291696) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is 4-[2-[3-(2-methylpropyl)phenyl]ethyl]-2-(2-phenylethylamino)benzoic acid.
| Compound Name | 4-[2-[3-(2-methylpropyl)phenyl]ethyl]-2-(2-phenylethylamino)benzoic acid |
|---|---|
| PubChem CID | 143291696 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 4-[2-[3-(2-methylpropyl)phenyl]ethyl]-2-(2-phenylethylamino)benzoic acid |
| SMILES | CC(C)Cc1cccc(CCc2ccc(C(=O)O)c(NCCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C27H31NO2/c1-20(2)17-24-10-6-9-22(18-24)11-12-23-13-14-25(27(29)30)26(19-23)28-16-15-21-7-4-3-5-8-21/h3-10,13-14,18-20,28H,11-12,15-17H2,1-2H3,(H,29,30) |
| InChIKey | SGGYERBRFQKZAQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |