C16H30O — CID 143292518
5-(2,4,4-trimethylpentan-2-yl)cyclooctan-1-one (PubChem CID 143292518) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 5-(2,4,4-trimethylpentan-2-yl)cyclooctan-1-one.
| Compound Name | 5-(2,4,4-trimethylpentan-2-yl)cyclooctan-1-one |
|---|---|
| PubChem CID | 143292518 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 5-(2,4,4-trimethylpentan-2-yl)cyclooctan-1-one |
| SMILES | CC(C)(C)CC(C)(C)C1CCCC(=O)CCC1 |
| InChI | InChI=1S/C16H30O/c1-15(2,3)12-16(4,5)13-8-6-10-14(17)11-7-9-13/h13H,6-12H2,1-5H3 |
| InChIKey | VXGDKUVRPVPVAZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |