C13H26O — CID 144733405
2,2-dimethylbutane;3-methylcyclohexan-1-one (PubChem CID 144733405) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is 2,2-dimethylbutane;3-methylcyclohexan-1-one.
| Compound Name | 2,2-dimethylbutane;3-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 144733405 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 2,2-dimethylbutane;3-methylcyclohexan-1-one |
| SMILES | CC1CCCC(=O)C1.CCC(C)(C)C |
| InChI | InChI=1S/C7H12O.C6H14/c1-6-3-2-4-7(8)5-6;1-5-6(2,3)4/h6H,2-5H2,1H3;5H2,1-4H3 |
| InChIKey | MLFGOYTVJDDWCO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |