About 2,2-dimethylbutane;3-methylcyclohexan-1-one
2,2-dimethylbutane;3-methylcyclohexan-1-one (PubChem CID 144733405) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is 2,2-dimethylbutane;3-methylcyclohexan-1-one.
Molecular Properties
| Compound Name | 2,2-dimethylbutane;3-methylcyclohexan-1-one |
| PubChem CID | 144733405 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 2,2-dimethylbutane;3-methylcyclohexan-1-one |
| SMILES | CC1CCCC(=O)C1.CCC(C)(C)C |
| InChI | InChI=1S/C7H12O.C6H14/c1-6-3-2-4-7(8)5-6;1-5-6(2,3)4/h6H,2-5H2,1H3;5H2,1-4H3 |
| InChIKey | MLFGOYTVJDDWCO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethylbutane;3-methylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylbutane;3-methylcyclohexan-1-one?
The IUPAC name of 2,2-dimethylbutane;3-methylcyclohexan-1-one (CID 144733405) is 2,2-dimethylbutane;3-methylcyclohexan-1-one.
What is the SMILES notation for 2,2-dimethylbutane;3-methylcyclohexan-1-one?
The canonical SMILES for 2,2-dimethylbutane;3-methylcyclohexan-1-one is CC1CCCC(=O)C1.CCC(C)(C)C.
What is the InChIKey of 2,2-dimethylbutane;3-methylcyclohexan-1-one?
The InChIKey is MLFGOYTVJDDWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C6H14/c1-6-3-2-4-7(8)5-6;1-5-6(2,3)4/h6H,2-5H2,1H3;5H2,1-4H3.
What are the key properties of 2,2-dimethylbutane;3-methylcyclohexan-1-one?
2,2-dimethylbutane;3-methylcyclohexan-1-one has a molecular weight of 198.35 g/mol, XLogP of 4.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylbutane;3-methylcyclohexan-1-one is sourced from PubChem (CID 144733405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).