C14H15N — CID 143292973
2-cyclohepta-1,3,5-trien-1-yl-N-methylaniline (PubChem CID 143292973) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-cyclohepta-1,3,5-trien-1-yl-N-methylaniline.
| Compound Name | 2-cyclohepta-1,3,5-trien-1-yl-N-methylaniline |
|---|---|
| PubChem CID | 143292973 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-cyclohepta-1,3,5-trien-1-yl-N-methylaniline |
| SMILES | CNc1ccccc1C1=CC=CC=CC1 |
| InChI | InChI=1S/C14H15N/c1-15-14-11-7-6-10-13(14)12-8-4-2-3-5-9-12/h2-8,10-11,15H,9H2,1H3 |
| InChIKey | GRTXAIHMSVUQHJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |