C15H18 — CID 145003907
methane;1-(2-methylphenyl)cyclohepta-1,3,5-triene (PubChem CID 145003907) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is methane;1-(2-methylphenyl)cyclohepta-1,3,5-triene.
| Compound Name | methane;1-(2-methylphenyl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 145003907 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | methane;1-(2-methylphenyl)cyclohepta-1,3,5-triene |
| SMILES | C.Cc1ccccc1C1=CC=CC=CC1 |
| InChI | InChI=1S/C14H14.CH4/c1-12-8-6-7-11-14(12)13-9-4-2-3-5-10-13;/h2-9,11H,10H2,1H3;1H4 |
| InChIKey | AFQPDIVRZKFIHP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |