C19H27N3O — CID 143293123
(Z)-1-phenylethene-1,2-diamine;1-phenylmethoxybutan-2-amine (PubChem CID 143293123) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is (Z)-1-phenylethene-1,2-diamine;1-phenylmethoxybutan-2-amine.
| Compound Name | (Z)-1-phenylethene-1,2-diamine;1-phenylmethoxybutan-2-amine |
|---|---|
| PubChem CID | 143293123 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (Z)-1-phenylethene-1,2-diamine;1-phenylmethoxybutan-2-amine |
| SMILES | CCC(N)COCc1ccccc1.N/C=C(\N)c1ccccc1 |
| InChI | InChI=1S/C11H17NO.C8H10N2/c1-2-11(12)9-13-8-10-6-4-3-5-7-10;9-6-8(10)7-4-2-1-3-5-7/h3-7,11H,2,8-9,12H2,1H3;1-6H,9-10H2/b;8-6- |
| InChIKey | GAGBRMISDQPSRP-SEUOEIGTSA-N |
| XLogP | 2.84 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |