C12H17NS — CID 143294770
3-methyl-7-[2-(methylamino)ethyl]cyclohepta-1,4,6-triene-1-carbothialdehyde (PubChem CID 143294770) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 3-methyl-7-[2-(methylamino)ethyl]cyclohepta-1,4,6-triene-1-carbothialdehyde.
| Compound Name | 3-methyl-7-[2-(methylamino)ethyl]cyclohepta-1,4,6-triene-1-carbothialdehyde |
|---|---|
| PubChem CID | 143294770 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3-methyl-7-[2-(methylamino)ethyl]cyclohepta-1,4,6-triene-1-carbothialdehyde |
| SMILES | CNCCC1=CC=CC(C)C=C1C=S |
| InChI | InChI=1S/C12H17NS/c1-10-4-3-5-11(6-7-13-2)12(8-10)9-14/h3-5,8-10,13H,6-7H2,1-2H3 |
| InChIKey | ANCLOTKHHXMKLL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|