C26H34O6 — CID 143295919
1-O-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl) 2-O-[(6S)-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl] benzene-1,2-dicarboxylate (PubChem CID 143295919) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is 1-O-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl) 2-O-[(6S)-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl) 2-O-[(6S)-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 143295919 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-O-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl) 2-O-[(6S)-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl] benzene-1,2-dicarboxylate |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2C(=O)OC2CC(C)(C)C[C@]3(C)OC23)C2OC2(C)C1 |
| InChI | InChI=1S/C26H34O6/c1-23(2)11-17(19-25(5,13-23)31-19)29-21(27)15-9-7-8-10-16(15)22(28)30-18-12-24(3,4)14-26(6)20(18)32-26/h7-10,17-20H,11-14H2,1-6H3/t17?,18?,19?,20?,25-,26?/m0/s1 |
| InChIKey | OAATVOFLNALPSM-SMOMDRAVSA-N |
| XLogP | 4.69 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|