C25H29N3OS — CID 143296310
(5-cyclohepta-1,3,5-trien-1-ylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)-(4-methylpiperidin-1-yl)methanone (PubChem CID 143296310) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is (5-cyclohepta-1,3,5-trien-1-ylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)-(4-methylpiperidin-1-yl)methanone.
| Compound Name | (5-cyclohepta-1,3,5-trien-1-ylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 143296310 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | (5-cyclohepta-1,3,5-trien-1-ylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc3c(c2)c2c(n3SC3=CC=CC=CC3)CCNC2)CC1 |
| InChI | InChI=1S/C25H29N3OS/c1-18-11-14-27(15-12-18)25(29)19-8-9-23-21(16-19)22-17-26-13-10-24(22)28(23)30-20-6-4-2-3-5-7-20/h2-6,8-9,16,18,26H,7,10-15,17H2,1H3 |
| InChIKey | UMRRMLDRJJSVOX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |