C22H28F2N3O3PS — CID 143296481
[1-(5-ethylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2-difluoro-2-phosphanylacetate (PubChem CID 143296481) has the molecular formula C22H28F2N3O3PS and a molecular weight of 483.52 g/mol. Its IUPAC name is [1-(5-ethylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2-difluoro-2-phosphanylacetate.
| Compound Name | [1-(5-ethylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2-difluoro-2-phosphanylacetate |
|---|---|
| PubChem CID | 143296481 |
| Molecular Formula | C22H28F2N3O3PS |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | [1-(5-ethylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2-difluoro-2-phosphanylacetate |
| SMILES | CCSn1c2c(c3cc(C(=O)N4CCC(COC(=O)C(F)(F)P)CC4)ccc31)CNCC2 |
| InChI | InChI=1S/C22H28F2N3O3PS/c1-2-32-27-18-4-3-15(11-16(18)17-12-25-8-5-19(17)27)20(28)26-9-6-14(7-10-26)13-30-21(29)22(23,24)31/h3-4,11,14,25H,2,5-10,12-13,31H2,1H3 |
| InChIKey | FXJPKCKYCSINEJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|