C22H26F3N3O3S — CID 143296516
[1-(5-ethylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 143296516) has the molecular formula C22H26F3N3O3S and a molecular weight of 469.53 g/mol. Its IUPAC name is [1-(5-ethylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [1-(5-ethylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 143296516 |
| Molecular Formula | C22H26F3N3O3S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [1-(5-ethylsulfanyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | CCSn1c2c(c3cc(C(=O)N4CCC(COC(=O)C(F)(F)F)CC4)ccc31)CNCC2 |
| InChI | InChI=1S/C22H26F3N3O3S/c1-2-32-28-18-4-3-15(11-16(18)17-12-26-8-5-19(17)28)20(29)27-9-6-14(7-10-27)13-31-21(30)22(23,24)25/h3-4,11,14,26H,2,5-10,12-13H2,1H3 |
| InChIKey | UQJODXWZHNHNPN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |