C33H34N2O4 — CID 143299133
ethane;5-[2-hydroxy-4-(3-hydroxyphenyl)phenyl]-4-[3-(4-methylphenyl)-3-oxopropyl]-1-phenylimidazolidin-2-one (PubChem CID 143299133) has the molecular formula C33H34N2O4 and a molecular weight of 522.65 g/mol. Its IUPAC name is ethane;5-[2-hydroxy-4-(3-hydroxyphenyl)phenyl]-4-[3-(4-methylphenyl)-3-oxopropyl]-1-phenylimidazolidin-2-one.
| Compound Name | ethane;5-[2-hydroxy-4-(3-hydroxyphenyl)phenyl]-4-[3-(4-methylphenyl)-3-oxopropyl]-1-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 143299133 |
| Molecular Formula | C33H34N2O4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | ethane;5-[2-hydroxy-4-(3-hydroxyphenyl)phenyl]-4-[3-(4-methylphenyl)-3-oxopropyl]-1-phenylimidazolidin-2-one |
| SMILES | CC.Cc1ccc(C(=O)CCC2NC(=O)N(c3ccccc3)C2c2ccc(-c3cccc(O)c3)cc2O)cc1 |
| InChI | InChI=1S/C31H28N2O4.C2H6/c1-20-10-12-21(13-11-20)28(35)17-16-27-30(33(31(37)32-27)24-7-3-2-4-8-24)26-15-14-23(19-29(26)36)22-6-5-9-25(34)18-22;1-2/h2-15,18-19,27,30,34,36H,16-17H2,1H3,(H,32,37);1-2H3 |
| InChIKey | UPFXUXDSVUCOFH-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|