C14H29F2N — CID 143299688
ethane;(E,2E)-3-fluoro-2-(1-fluoropropylidene)hept-3-en-1-amine (PubChem CID 143299688) has the molecular formula C14H29F2N and a molecular weight of 249.39 g/mol. Its IUPAC name is ethane;(E,2E)-3-fluoro-2-(1-fluoropropylidene)hept-3-en-1-amine.
| Compound Name | ethane;(E,2E)-3-fluoro-2-(1-fluoropropylidene)hept-3-en-1-amine |
|---|---|
| PubChem CID | 143299688 |
| Molecular Formula | C14H29F2N |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.23 |
| IUPAC Name | ethane;(E,2E)-3-fluoro-2-(1-fluoropropylidene)hept-3-en-1-amine |
| SMILES | CC.CC.CCC/C=C(F)\C(CN)=C(\F)CC |
| InChI | InChI=1S/C10H17F2N.2C2H6/c1-3-5-6-10(12)8(7-13)9(11)4-2;2*1-2/h6H,3-5,7,13H2,1-2H3;2*1-2H3/b9-8+,10-6+;; |
| InChIKey | CIGMUUZKATVOAX-BCOAGSNSSA-N |
| XLogP | 5.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|