C16H21N3O3 — CID 143301248
ethane;formamide;methyl 3-(pyridin-4-ylamino)benzoate (PubChem CID 143301248) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethane;formamide;methyl 3-(pyridin-4-ylamino)benzoate.
| Compound Name | ethane;formamide;methyl 3-(pyridin-4-ylamino)benzoate |
|---|---|
| PubChem CID | 143301248 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | ethane;formamide;methyl 3-(pyridin-4-ylamino)benzoate |
| SMILES | CC.COC(=O)c1cccc(Nc2ccncc2)c1.NC=O |
| InChI | InChI=1S/C13H12N2O2.C2H6.CH3NO/c1-17-13(16)10-3-2-4-12(9-10)15-11-5-7-14-8-6-11;1-2;2-1-3/h2-9H,1H3,(H,14,15);1-2H3;1H,(H2,2,3) |
| InChIKey | NOEMYENELWAAEX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|