C24H28N4O4 — CID 143305154
2,6-diamino-N-[[6-[2-[(3E)-penta-1,3-dien-3-yl]oxyethoxy]-1-benzofuran-2-yl]methyl]pyridine-3-carboxamide;ethene (PubChem CID 143305154) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2,6-diamino-N-[[6-[2-[(3E)-penta-1,3-dien-3-yl]oxyethoxy]-1-benzofuran-2-yl]methyl]pyridine-3-carboxamide;ethene.
| Compound Name | 2,6-diamino-N-[[6-[2-[(3E)-penta-1,3-dien-3-yl]oxyethoxy]-1-benzofuran-2-yl]methyl]pyridine-3-carboxamide;ethene |
|---|---|
| PubChem CID | 143305154 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2,6-diamino-N-[[6-[2-[(3E)-penta-1,3-dien-3-yl]oxyethoxy]-1-benzofuran-2-yl]methyl]pyridine-3-carboxamide;ethene |
| SMILES | C=C.C=C/C(=C\C)OCCOc1ccc2cc(CNC(=O)c3ccc(N)nc3N)oc2c1 |
| InChI | InChI=1S/C22H24N4O4.C2H4/c1-3-15(4-2)28-9-10-29-16-6-5-14-11-17(30-19(14)12-16)13-25-22(27)18-7-8-20(23)26-21(18)24;1-2/h3-8,11-12H,1,9-10,13H2,2H3,(H,25,27)(H4,23,24,26);1-2H2/b15-4+; |
| InChIKey | HIJUWZYLCQUUFH-HDNKIUSMSA-N |
| XLogP | 4.21 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|