About ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine
ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine (PubChem CID 143305969) has the molecular formula C18H42N2
and a molecular weight of 286.55 g/mol. Its IUPAC name is ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine.
Molecular Properties
| Compound Name | ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine |
| PubChem CID | 143305969 |
| Molecular Formula | C18H42N2 |
| Molecular Weight | 286.55 g/mol |
| Exact Mass | 286.33 |
| IUPAC Name | ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine |
| SMILES | CC.CCC1CCN(C)CC1.CCCCC(CC)NC |
| InChI | InChI=1S/C8H17N.C8H19N.C2H6/c1-3-8-4-6-9(2)7-5-8;1-4-6-7-8(5-2)9-3;1-2/h8H,3-7H2,1-2H3;8-9H,4-7H2,1-3H3;1-2H3 |
| InChIKey | AAYUXGADQZRJGD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine?
The IUPAC name of ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine (CID 143305969) is ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine.
What is the SMILES notation for ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine?
The canonical SMILES for ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine is CC.CCC1CCN(C)CC1.CCCCC(CC)NC.
What is the InChIKey of ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine?
The InChIKey is AAYUXGADQZRJGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C8H19N.C2H6/c1-3-8-4-6-9(2)7-5-8;1-4-6-7-8(5-2)9-3;1-2/h8H,3-7H2,1-2H3;8-9H,4-7H2,1-3H3;1-2H3.
What are the key properties of ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine?
ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine has a molecular weight of 286.55 g/mol, XLogP of 4.94, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-1-methylpiperidine;N-methylheptan-3-amine is sourced from PubChem (CID 143305969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).