About carbanide;N-methyltridecan-3-amine;vanadium
carbanide;N-methyltridecan-3-amine;vanadium (PubChem CID 170975865) has the molecular formula C15H34NV-
and a molecular weight of 279.39 g/mol. Its IUPAC name is carbanide;N-methyltridecan-3-amine;vanadium.
Molecular Properties
| Compound Name | carbanide;N-methyltridecan-3-amine;vanadium |
| PubChem CID | 170975865 |
| Molecular Formula | C15H34NV- |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | carbanide;N-methyltridecan-3-amine;vanadium |
| SMILES | CCCCCCCCCCC(CC)NC.[CH3-].[V] |
| InChI | InChI=1S/C14H31N.CH3.V/c1-4-6-7-8-9-10-11-12-13-14(5-2)15-3;;/h14-15H,4-13H2,1-3H3;1H3;/q;-1; |
| InChIKey | WXWNLTXILNDFSA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;N-methyltridecan-3-amine;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;N-methyltridecan-3-amine;vanadium?
The IUPAC name of carbanide;N-methyltridecan-3-amine;vanadium (CID 170975865) is carbanide;N-methyltridecan-3-amine;vanadium.
What is the SMILES notation for carbanide;N-methyltridecan-3-amine;vanadium?
The canonical SMILES for carbanide;N-methyltridecan-3-amine;vanadium is CCCCCCCCCCC(CC)NC.[CH3-].[V].
What is the InChIKey of carbanide;N-methyltridecan-3-amine;vanadium?
The InChIKey is WXWNLTXILNDFSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N.CH3.V/c1-4-6-7-8-9-10-11-12-13-14(5-2)15-3;;/h14-15H,4-13H2,1-3H3;1H3;/q;-1;.
What are the key properties of carbanide;N-methyltridecan-3-amine;vanadium?
carbanide;N-methyltridecan-3-amine;vanadium has a molecular weight of 279.39 g/mol, XLogP of 4.96, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;N-methyltridecan-3-amine;vanadium is sourced from PubChem (CID 170975865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).