About 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine
2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine (PubChem CID 143306531) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine.
Molecular Properties
| Compound Name | 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine |
| PubChem CID | 143306531 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine |
| SMILES | C=C/C=C(\C=C)COC1CCCC1N |
| InChI | InChI=1S/C12H19NO/c1-3-6-10(4-2)9-14-12-8-5-7-11(12)13/h3-4,6,11-12H,1-2,5,7-9,13H2/b10-6+ |
| InChIKey | MUWMIOGSJVHJDP-UXBLZVDNSA-N |
| XLogP | 2.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine?
The IUPAC name of 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine (CID 143306531) is 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine.
What is the SMILES notation for 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine?
The canonical SMILES for 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine is C=C/C=C(\C=C)COC1CCCC1N.
What is the InChIKey of 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine?
The InChIKey is MUWMIOGSJVHJDP-UXBLZVDNSA-N. The full InChI is InChI=1S/C12H19NO/c1-3-6-10(4-2)9-14-12-8-5-7-11(12)13/h3-4,6,11-12H,1-2,5,7-9,13H2/b10-6+.
What are the key properties of 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine?
2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine has a molecular weight of 193.29 g/mol, XLogP of 2.18, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-2-ethenylpenta-2,4-dienoxy]cyclopentan-1-amine is sourced from PubChem (CID 143306531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).