C13H21NO — CID 143585699
(1S)-2-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]cyclopentan-1-amine (PubChem CID 143585699) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (1S)-2-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]cyclopentan-1-amine.
| Compound Name | (1S)-2-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]cyclopentan-1-amine |
|---|---|
| PubChem CID | 143585699 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (1S)-2-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]cyclopentan-1-amine |
| SMILES | C=C/C=C(\C=C/C)COC1CCC[C@@H]1N |
| InChI | InChI=1S/C13H21NO/c1-3-6-11(7-4-2)10-15-13-9-5-8-12(13)14/h3-4,6-7,12-13H,1,5,8-10,14H2,2H3/b7-4-,11-6+/t12-,13?/m0/s1 |
| InChIKey | XHVZWNMNJUKBPP-WSWJHGSLSA-N |
| XLogP | 2.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|