C11H17NO — CID 143522212
2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxolan-3-amine (PubChem CID 143522212) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxolan-3-amine.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxolan-3-amine |
|---|---|
| PubChem CID | 143522212 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxolan-3-amine |
| SMILES | C=C/C(=C\C=C/C)C1OCCC1N |
| InChI | InChI=1S/C11H17NO/c1-3-5-6-9(4-2)11-10(12)7-8-13-11/h3-6,10-11H,2,7-8,12H2,1H3/b5-3-,9-6+ |
| InChIKey | QCXNVMVBUKKPSI-PAEKIZANSA-N |
| XLogP | 1.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|