C10H15NO — CID 143522196
2-[(3E)-hexa-1,3,5-trien-3-yl]oxolan-3-amine (PubChem CID 143522196) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]oxolan-3-amine.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxolan-3-amine |
|---|---|
| PubChem CID | 143522196 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxolan-3-amine |
| SMILES | C=C/C=C(\C=C)C1OCCC1N |
| InChI | InChI=1S/C10H15NO/c1-3-5-8(4-2)10-9(11)6-7-12-10/h3-5,9-10H,1-2,6-7,11H2/b8-5+ |
| InChIKey | XMVABEURWNUWQT-VMPITWQZSA-N |
| XLogP | 1.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|