C14H25NO — CID 143260495
3-(cyclohexa-1,3-dien-1-ylmethoxy)heptan-4-amine (PubChem CID 143260495) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 3-(cyclohexa-1,3-dien-1-ylmethoxy)heptan-4-amine.
| Compound Name | 3-(cyclohexa-1,3-dien-1-ylmethoxy)heptan-4-amine |
|---|---|
| PubChem CID | 143260495 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 3-(cyclohexa-1,3-dien-1-ylmethoxy)heptan-4-amine |
| SMILES | CCCC(N)C(CC)OCC1=CC=CCC1 |
| InChI | InChI=1S/C14H25NO/c1-3-8-13(15)14(4-2)16-11-12-9-6-5-7-10-12/h5-6,9,13-14H,3-4,7-8,10-11,15H2,1-2H3 |
| InChIKey | XNTJTIMAXXXXNI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |