C12H22FNO — CID 129313612
(Z,4E)-4-ethylidene-1-fluoro-3-methoxynon-5-en-2-amine (PubChem CID 129313612) has the molecular formula C12H22FNO and a molecular weight of 215.31 g/mol. Its IUPAC name is (Z,4E)-4-ethylidene-1-fluoro-3-methoxynon-5-en-2-amine.
| Compound Name | (Z,4E)-4-ethylidene-1-fluoro-3-methoxynon-5-en-2-amine |
|---|---|
| PubChem CID | 129313612 |
| Molecular Formula | C12H22FNO |
| Molecular Weight | 215.31 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (Z,4E)-4-ethylidene-1-fluoro-3-methoxynon-5-en-2-amine |
| SMILES | C/C=C(\C=C/CCC)C(OC)C(N)CF |
| InChI | InChI=1S/C12H22FNO/c1-4-6-7-8-10(5-2)12(15-3)11(14)9-13/h5,7-8,11-12H,4,6,9,14H2,1-3H3/b8-7-,10-5+ |
| InChIKey | GYGZPRQNBMNITE-GBLFQTLVSA-N |
| XLogP | 2.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|