C13H21NO — CID 123645511
5-(2-methoxycyclohexa-2,4-dien-1-ylidene)hexan-3-amine (PubChem CID 123645511) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 5-(2-methoxycyclohexa-2,4-dien-1-ylidene)hexan-3-amine.
| Compound Name | 5-(2-methoxycyclohexa-2,4-dien-1-ylidene)hexan-3-amine |
|---|---|
| PubChem CID | 123645511 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 5-(2-methoxycyclohexa-2,4-dien-1-ylidene)hexan-3-amine |
| SMILES | CCC(N)CC(C)=C1CC=CC=C1OC |
| InChI | InChI=1S/C13H21NO/c1-4-11(14)9-10(2)12-7-5-6-8-13(12)15-3/h5-6,8,11H,4,7,9,14H2,1-3H3 |
| InChIKey | KPZAROPJDYUZJS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |