C11H18INO2 — CID 164885996
(2R)-1-(4-iodo-2,4-dimethoxycyclohexa-1,5-dien-1-yl)propan-2-amine (PubChem CID 164885996) has the molecular formula C11H18INO2 and a molecular weight of 323.17 g/mol. Its IUPAC name is (2R)-1-(4-iodo-2,4-dimethoxycyclohexa-1,5-dien-1-yl)propan-2-amine.
| Compound Name | (2R)-1-(4-iodo-2,4-dimethoxycyclohexa-1,5-dien-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 164885996 |
| Molecular Formula | C11H18INO2 |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | (2R)-1-(4-iodo-2,4-dimethoxycyclohexa-1,5-dien-1-yl)propan-2-amine |
| SMILES | COC1=C(C[C@@H](C)N)C=CC(I)(OC)C1 |
| InChI | InChI=1S/C11H18INO2/c1-8(13)6-9-4-5-11(12,15-3)7-10(9)14-2/h4-5,8H,6-7,13H2,1-3H3/t8-,11?/m1/s1 |
| InChIKey | YYYZDPSIXYHXJX-RZZZFEHKSA-N |
| XLogP | 2.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|