C11H19NO — CID 165123596
(4E,6Z)-4-ethenyl-5-methoxyocta-4,6-dien-2-amine (PubChem CID 165123596) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (4E,6Z)-4-ethenyl-5-methoxyocta-4,6-dien-2-amine.
| Compound Name | (4E,6Z)-4-ethenyl-5-methoxyocta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 165123596 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (4E,6Z)-4-ethenyl-5-methoxyocta-4,6-dien-2-amine |
| SMILES | C=C/C(CC(C)N)=C(\C=C/C)OC |
| InChI | InChI=1S/C11H19NO/c1-5-7-11(13-4)10(6-2)8-9(3)12/h5-7,9H,2,8,12H2,1,3-4H3/b7-5-,11-10- |
| InChIKey | BUXNHNPAKZZPFD-YLRXWAGNSA-N |
| XLogP | 2.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|