C10H15NO — CID 154687239
3,4-bis(ethenyl)-2-methoxycyclopent-3-en-1-amine (PubChem CID 154687239) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-2-methoxycyclopent-3-en-1-amine.
| Compound Name | 3,4-bis(ethenyl)-2-methoxycyclopent-3-en-1-amine |
|---|---|
| PubChem CID | 154687239 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 3,4-bis(ethenyl)-2-methoxycyclopent-3-en-1-amine |
| SMILES | C=CC1=C(C=C)C(OC)C(N)C1 |
| InChI | InChI=1S/C10H15NO/c1-4-7-6-9(11)10(12-3)8(7)5-2/h4-5,9-10H,1-2,6,11H2,3H3 |
| InChIKey | GFVRGRXZEMFLGN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |